C15H32S2 — CID 130381127
2,3,3,8,9-pentamethyldecane-2,9-dithiol (PubChem CID 130381127) has the molecular formula C15H32S2 and a molecular weight of 276.56 g/mol. Its IUPAC name is 2,3,3,8,9-pentamethyldecane-2,9-dithiol.
| Compound Name | 2,3,3,8,9-pentamethyldecane-2,9-dithiol |
|---|---|
| PubChem CID | 130381127 |
| Molecular Formula | C15H32S2 |
| Molecular Weight | 276.56 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 2,3,3,8,9-pentamethyldecane-2,9-dithiol |
| SMILES | CC(CCCCC(C)(C)C(C)(C)S)C(C)(C)S |
| InChI | InChI=1S/C15H32S2/c1-12(14(4,5)16)10-8-9-11-13(2,3)15(6,7)17/h12,16-17H,8-11H2,1-7H3 |
| InChIKey | RWBSBRUYSPKHCQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|