About (2S)-1-N-(2-iodoethyl)pentane-1,2,5-triamine
(2S)-1-N-(2-iodoethyl)pentane-1,2,5-triamine (PubChem CID 130381439) has the molecular formula C7H18IN3
and a molecular weight of 271.15 g/mol. Its IUPAC name is (2S)-1-N-(2-iodoethyl)pentane-1,2,5-triamine.
Molecular Properties
| Compound Name | (2S)-1-N-(2-iodoethyl)pentane-1,2,5-triamine |
| PubChem CID | 130381439 |
| Molecular Formula | C7H18IN3 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | (2S)-1-N-(2-iodoethyl)pentane-1,2,5-triamine |
| SMILES | NCCC[C@H](N)CNCCI |
| InChI | InChI=1S/C7H18IN3/c8-3-5-11-6-7(10)2-1-4-9/h7,11H,1-6,9-10H2/t7-/m0/s1 |
| InChIKey | RBLJFZBQKCRQPD-ZETCQYMHSA-N |
| XLogP | 0.08 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-N-(2-iodoethyl)pentane-1,2,5-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-N-(2-iodoethyl)pentane-1,2,5-triamine?
The IUPAC name of (2S)-1-N-(2-iodoethyl)pentane-1,2,5-triamine (CID 130381439) is (2S)-1-N-(2-iodoethyl)pentane-1,2,5-triamine.
What is the SMILES notation for (2S)-1-N-(2-iodoethyl)pentane-1,2,5-triamine?
The canonical SMILES for (2S)-1-N-(2-iodoethyl)pentane-1,2,5-triamine is NCCC[C@H](N)CNCCI.
What is the InChIKey of (2S)-1-N-(2-iodoethyl)pentane-1,2,5-triamine?
The InChIKey is RBLJFZBQKCRQPD-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H18IN3/c8-3-5-11-6-7(10)2-1-4-9/h7,11H,1-6,9-10H2/t7-/m0/s1.
What are the key properties of (2S)-1-N-(2-iodoethyl)pentane-1,2,5-triamine?
(2S)-1-N-(2-iodoethyl)pentane-1,2,5-triamine has a molecular weight of 271.15 g/mol, XLogP of 0.08, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-N-(2-iodoethyl)pentane-1,2,5-triamine is sourced from PubChem (CID 130381439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).