About tert-butyl N-[3-[3,5-bis(4-fluorophenyl)phenyl]propyl]carbamate
tert-butyl N-[3-[3,5-bis(4-fluorophenyl)phenyl]propyl]carbamate (PubChem CID 130381474) has the molecular formula C26H27F2NO2
and a molecular weight of 423.50 g/mol. Its IUPAC name is tert-butyl N-[3-[3,5-bis(4-fluorophenyl)phenyl]propyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[3-[3,5-bis(4-fluorophenyl)phenyl]propyl]carbamate |
| PubChem CID | 130381474 |
| Molecular Formula | C26H27F2NO2 |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | tert-butyl N-[3-[3,5-bis(4-fluorophenyl)phenyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCc1cc(-c2ccc(F)cc2)cc(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C26H27F2NO2/c1-26(2,3)31-25(30)29-14-4-5-18-15-21(19-6-10-23(27)11-7-19)17-22(16-18)20-8-12-24(28)13-9-20/h6-13,15-17H,4-5,14H2,1-3H3,(H,29,30) |
| InChIKey | MVKHISAOZYARKF-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[3-[3,5-bis(4-fluorophenyl)phenyl]propyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[3-[3,5-bis(4-fluorophenyl)phenyl]propyl]carbamate?
The IUPAC name of tert-butyl N-[3-[3,5-bis(4-fluorophenyl)phenyl]propyl]carbamate (CID 130381474) is tert-butyl N-[3-[3,5-bis(4-fluorophenyl)phenyl]propyl]carbamate.
What is the SMILES notation for tert-butyl N-[3-[3,5-bis(4-fluorophenyl)phenyl]propyl]carbamate?
The canonical SMILES for tert-butyl N-[3-[3,5-bis(4-fluorophenyl)phenyl]propyl]carbamate is CC(C)(C)OC(=O)NCCCc1cc(-c2ccc(F)cc2)cc(-c2ccc(F)cc2)c1.
What is the InChIKey of tert-butyl N-[3-[3,5-bis(4-fluorophenyl)phenyl]propyl]carbamate?
The InChIKey is MVKHISAOZYARKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27F2NO2/c1-26(2,3)31-25(30)29-14-4-5-18-15-21(19-6-10-23(27)11-7-19)17-22(16-18)20-8-12-24(28)13-9-20/h6-13,15-17H,4-5,14H2,1-3H3,(H,29,30).
What are the key properties of tert-butyl N-[3-[3,5-bis(4-fluorophenyl)phenyl]propyl]carbamate?
tert-butyl N-[3-[3,5-bis(4-fluorophenyl)phenyl]propyl]carbamate has a molecular weight of 423.50 g/mol, XLogP of 6.76, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[3-[3,5-bis(4-fluorophenyl)phenyl]propyl]carbamate is sourced from PubChem (CID 130381474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).