C17H22FN3O3 — CID 130381743
N-[(1Z,3E)-4-fluoro-1-(methylideneamino)penta-1,3-dienyl]-4-[(2S)-1-methoxypropan-2-yl]oxy-6-methylpyridine-2-carboxamide (PubChem CID 130381743) has the molecular formula C17H22FN3O3 and a molecular weight of 335.38 g/mol. Its IUPAC name is N-[(1Z,3E)-4-fluoro-1-(methylideneamino)penta-1,3-dienyl]-4-[(2S)-1-methoxypropan-2-yl]oxy-6-methylpyridine-2-carboxamide.
| Compound Name | N-[(1Z,3E)-4-fluoro-1-(methylideneamino)penta-1,3-dienyl]-4-[(2S)-1-methoxypropan-2-yl]oxy-6-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 130381743 |
| Molecular Formula | C17H22FN3O3 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N-[(1Z,3E)-4-fluoro-1-(methylideneamino)penta-1,3-dienyl]-4-[(2S)-1-methoxypropan-2-yl]oxy-6-methylpyridine-2-carboxamide |
| SMILES | C=N/C(=C\C=C(/C)F)NC(=O)c1cc(O[C@@H](C)COC)cc(C)n1 |
| InChI | InChI=1S/C17H22FN3O3/c1-11(18)6-7-16(19-4)21-17(22)15-9-14(8-12(2)20-15)24-13(3)10-23-5/h6-9,13H,4,10H2,1-3,5H3,(H,21,22)/b11-6+,16-7+/t13-/m0/s1 |
| InChIKey | UNTPYZCUXLIWRN-CHHSGRGESA-N |
| XLogP | 2.95 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|