methyl 2,2-dimethylspiro[2.4]hepta-4,6-diene-1-carboxylate

C11H14O2 — CID 130382338

IUPACmethyl 2,2-dimethylspiro[2.4]hepta-4,6-diene-1-carboxylate
SMILESCOC(=O)C1C(C)(C)C12C=CC=C2
InChIInChI=1S/C11H14O2/c1-10(2)8(9(12)13-3)11(10)6-4-5-7-11/h4-8H,1-3H3
InChIKeyKYGWECSSNPBCHR-UHFFFAOYSA-N
MW178.23 g/mol
LogP1.93
Rot. Bonds1

About methyl 2,2-dimethylspiro[2.4]hepta-4,6-diene-1-carboxylate

methyl 2,2-dimethylspiro[2.4]hepta-4,6-diene-1-carboxylate (PubChem CID 130382338) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is methyl 2,2-dimethylspiro[2.4]hepta-4,6-diene-1-carboxylate.

Molecular Properties

Compound Namemethyl 2,2-dimethylspiro[2.4]hepta-4,6-diene-1-carboxylate
PubChem CID130382338
Molecular FormulaC11H14O2
Molecular Weight178.23 g/mol
Exact Mass178.10
IUPAC Namemethyl 2,2-dimethylspiro[2.4]hepta-4,6-diene-1-carboxylate
SMILESCOC(=O)C1C(C)(C)C12C=CC=C2
InChIInChI=1S/C11H14O2/c1-10(2)8(9(12)13-3)11(10)6-4-5-7-11/h4-8H,1-3H3
InChIKeyKYGWECSSNPBCHR-UHFFFAOYSA-N
XLogP1.93
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.23
LogP ≤ 51.93
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 2,2-dimethylspiro[2.4]hepta-4,6-diene-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,2-dimethylspiro[2.4]hepta-4,6-diene-1-carboxylate?
The IUPAC name of methyl 2,2-dimethylspiro[2.4]hepta-4,6-diene-1-carboxylate (CID 130382338) is methyl 2,2-dimethylspiro[2.4]hepta-4,6-diene-1-carboxylate.
What is the SMILES notation for methyl 2,2-dimethylspiro[2.4]hepta-4,6-diene-1-carboxylate?
The canonical SMILES for methyl 2,2-dimethylspiro[2.4]hepta-4,6-diene-1-carboxylate is COC(=O)C1C(C)(C)C12C=CC=C2.
What is the InChIKey of methyl 2,2-dimethylspiro[2.4]hepta-4,6-diene-1-carboxylate?
The InChIKey is KYGWECSSNPBCHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-10(2)8(9(12)13-3)11(10)6-4-5-7-11/h4-8H,1-3H3.
What are the key properties of methyl 2,2-dimethylspiro[2.4]hepta-4,6-diene-1-carboxylate?
methyl 2,2-dimethylspiro[2.4]hepta-4,6-diene-1-carboxylate has a molecular weight of 178.23 g/mol, XLogP of 1.93, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2-dimethylspiro[2.4]hepta-4,6-diene-1-carboxylate is sourced from PubChem (CID 130382338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).