About 7-chloro-4-ethyl-4-[2-(2-methylphenyl)ethyl]-2,3-dihydro-1H-naphthalene
7-chloro-4-ethyl-4-[2-(2-methylphenyl)ethyl]-2,3-dihydro-1H-naphthalene (PubChem CID 130382547) has the molecular formula C21H25Cl
and a molecular weight of 312.88 g/mol. Its IUPAC name is 7-chloro-4-ethyl-4-[2-(2-methylphenyl)ethyl]-2,3-dihydro-1H-naphthalene.
Molecular Properties
| Compound Name | 7-chloro-4-ethyl-4-[2-(2-methylphenyl)ethyl]-2,3-dihydro-1H-naphthalene |
| PubChem CID | 130382547 |
| Molecular Formula | C21H25Cl |
| Molecular Weight | 312.88 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 7-chloro-4-ethyl-4-[2-(2-methylphenyl)ethyl]-2,3-dihydro-1H-naphthalene |
| SMILES | CCC1(CCc2ccccc2C)CCCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H25Cl/c1-3-21(14-12-17-8-5-4-7-16(17)2)13-6-9-18-15-19(22)10-11-20(18)21/h4-5,7-8,10-11,15H,3,6,9,12-14H2,1-2H3 |
| InChIKey | RKYRGCUZFCTZKZ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.88 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7-chloro-4-ethyl-4-[2-(2-methylphenyl)ethyl]-2,3-dihydro-1H-naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-4-ethyl-4-[2-(2-methylphenyl)ethyl]-2,3-dihydro-1H-naphthalene?
The IUPAC name of 7-chloro-4-ethyl-4-[2-(2-methylphenyl)ethyl]-2,3-dihydro-1H-naphthalene (CID 130382547) is 7-chloro-4-ethyl-4-[2-(2-methylphenyl)ethyl]-2,3-dihydro-1H-naphthalene.
What is the SMILES notation for 7-chloro-4-ethyl-4-[2-(2-methylphenyl)ethyl]-2,3-dihydro-1H-naphthalene?
The canonical SMILES for 7-chloro-4-ethyl-4-[2-(2-methylphenyl)ethyl]-2,3-dihydro-1H-naphthalene is CCC1(CCc2ccccc2C)CCCc2cc(Cl)ccc21.
What is the InChIKey of 7-chloro-4-ethyl-4-[2-(2-methylphenyl)ethyl]-2,3-dihydro-1H-naphthalene?
The InChIKey is RKYRGCUZFCTZKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25Cl/c1-3-21(14-12-17-8-5-4-7-16(17)2)13-6-9-18-15-19(22)10-11-20(18)21/h4-5,7-8,10-11,15H,3,6,9,12-14H2,1-2H3.
What are the key properties of 7-chloro-4-ethyl-4-[2-(2-methylphenyl)ethyl]-2,3-dihydro-1H-naphthalene?
7-chloro-4-ethyl-4-[2-(2-methylphenyl)ethyl]-2,3-dihydro-1H-naphthalene has a molecular weight of 312.88 g/mol, XLogP of 6.27, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-4-ethyl-4-[2-(2-methylphenyl)ethyl]-2,3-dihydro-1H-naphthalene is sourced from PubChem (CID 130382547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).