About 2-but-3-enyl-1-hexan-2-yl-6-methyl-2,3-dihydroindole
2-but-3-enyl-1-hexan-2-yl-6-methyl-2,3-dihydroindole (PubChem CID 130382610) has the molecular formula C19H29N
and a molecular weight of 271.45 g/mol. Its IUPAC name is 2-but-3-enyl-1-hexan-2-yl-6-methyl-2,3-dihydroindole.
Molecular Properties
| Compound Name | 2-but-3-enyl-1-hexan-2-yl-6-methyl-2,3-dihydroindole |
| PubChem CID | 130382610 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 2-but-3-enyl-1-hexan-2-yl-6-methyl-2,3-dihydroindole |
| SMILES | C=CCCC1Cc2ccc(C)cc2N1C(C)CCCC |
| InChI | InChI=1S/C19H29N/c1-5-7-9-16(4)20-18(10-8-6-2)14-17-12-11-15(3)13-19(17)20/h6,11-13,16,18H,2,5,7-10,14H2,1,3-4H3 |
| InChIKey | ZCDLKLXLOQGQNK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-but-3-enyl-1-hexan-2-yl-6-methyl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-3-enyl-1-hexan-2-yl-6-methyl-2,3-dihydroindole?
The IUPAC name of 2-but-3-enyl-1-hexan-2-yl-6-methyl-2,3-dihydroindole (CID 130382610) is 2-but-3-enyl-1-hexan-2-yl-6-methyl-2,3-dihydroindole.
What is the SMILES notation for 2-but-3-enyl-1-hexan-2-yl-6-methyl-2,3-dihydroindole?
The canonical SMILES for 2-but-3-enyl-1-hexan-2-yl-6-methyl-2,3-dihydroindole is C=CCCC1Cc2ccc(C)cc2N1C(C)CCCC.
What is the InChIKey of 2-but-3-enyl-1-hexan-2-yl-6-methyl-2,3-dihydroindole?
The InChIKey is ZCDLKLXLOQGQNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29N/c1-5-7-9-16(4)20-18(10-8-6-2)14-17-12-11-15(3)13-19(17)20/h6,11-13,16,18H,2,5,7-10,14H2,1,3-4H3.
What are the key properties of 2-but-3-enyl-1-hexan-2-yl-6-methyl-2,3-dihydroindole?
2-but-3-enyl-1-hexan-2-yl-6-methyl-2,3-dihydroindole has a molecular weight of 271.45 g/mol, XLogP of 5.27, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-3-enyl-1-hexan-2-yl-6-methyl-2,3-dihydroindole is sourced from PubChem (CID 130382610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).