About (5E)-7-oxa-1,6-diazabicyclo[6.2.2]dodec-5-en-5-amine
(5E)-7-oxa-1,6-diazabicyclo[6.2.2]dodec-5-en-5-amine (PubChem CID 130383392) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is (5E)-7-oxa-1,6-diazabicyclo[6.2.2]dodec-5-en-5-amine.
Molecular Properties
| Compound Name | (5E)-7-oxa-1,6-diazabicyclo[6.2.2]dodec-5-en-5-amine |
| PubChem CID | 130383392 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (5E)-7-oxa-1,6-diazabicyclo[6.2.2]dodec-5-en-5-amine |
| SMILES | N/C1=N/OC2CCN(CCC1)CC2 |
| InChI | InChI=1S/C9H17N3O/c10-9-2-1-5-12-6-3-8(4-7-12)13-11-9/h8H,1-7H2,(H2,10,11) |
| InChIKey | MNFTWJXOCTXROI-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5E)-7-oxa-1,6-diazabicyclo[6.2.2]dodec-5-en-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-7-oxa-1,6-diazabicyclo[6.2.2]dodec-5-en-5-amine?
The IUPAC name of (5E)-7-oxa-1,6-diazabicyclo[6.2.2]dodec-5-en-5-amine (CID 130383392) is (5E)-7-oxa-1,6-diazabicyclo[6.2.2]dodec-5-en-5-amine.
What is the SMILES notation for (5E)-7-oxa-1,6-diazabicyclo[6.2.2]dodec-5-en-5-amine?
The canonical SMILES for (5E)-7-oxa-1,6-diazabicyclo[6.2.2]dodec-5-en-5-amine is N/C1=N/OC2CCN(CCC1)CC2.
What is the InChIKey of (5E)-7-oxa-1,6-diazabicyclo[6.2.2]dodec-5-en-5-amine?
The InChIKey is MNFTWJXOCTXROI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O/c10-9-2-1-5-12-6-3-8(4-7-12)13-11-9/h8H,1-7H2,(H2,10,11).
What are the key properties of (5E)-7-oxa-1,6-diazabicyclo[6.2.2]dodec-5-en-5-amine?
(5E)-7-oxa-1,6-diazabicyclo[6.2.2]dodec-5-en-5-amine has a molecular weight of 183.25 g/mol, XLogP of 0.53, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-7-oxa-1,6-diazabicyclo[6.2.2]dodec-5-en-5-amine is sourced from PubChem (CID 130383392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).