C12H9F13N2S — CID 130383616
1-methyl-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)imidazole (PubChem CID 130383616) has the molecular formula C12H9F13N2S and a molecular weight of 460.26 g/mol. Its IUPAC name is 1-methyl-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)imidazole.
| Compound Name | 1-methyl-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)imidazole |
|---|---|
| PubChem CID | 130383616 |
| Molecular Formula | C12H9F13N2S |
| Molecular Weight | 460.26 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | 1-methyl-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)imidazole |
| SMILES | Cn1ccnc1SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H9F13N2S/c1-27-4-3-26-6(27)28-5-2-7(13,14)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h3-4H,2,5H2,1H3 |
| InChIKey | VMXKZMHOSSVUHY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.26 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|