C20H12O10 — CID 130383900
4,6,8-trihydroxy-5-[(7R)-2,4,7-trihydroxy-5,6-dioxo-7,8-dihydronaphthalen-1-yl]naphthalene-1,2-dione (PubChem CID 130383900) has the molecular formula C20H12O10 and a molecular weight of 412.31 g/mol. Its IUPAC name is 4,6,8-trihydroxy-5-[(7R)-2,4,7-trihydroxy-5,6-dioxo-7,8-dihydronaphthalen-1-yl]naphthalene-1,2-dione.
| Compound Name | 4,6,8-trihydroxy-5-[(7R)-2,4,7-trihydroxy-5,6-dioxo-7,8-dihydronaphthalen-1-yl]naphthalene-1,2-dione |
|---|---|
| PubChem CID | 130383900 |
| Molecular Formula | C20H12O10 |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 4,6,8-trihydroxy-5-[(7R)-2,4,7-trihydroxy-5,6-dioxo-7,8-dihydronaphthalen-1-yl]naphthalene-1,2-dione |
| SMILES | O=C1C=C(O)c2c(c(O)cc(O)c2-c2c(O)cc(O)c3c2C[C@@H](O)C(=O)C3=O)C1=O |
| InChI | InChI=1S/C20H12O10/c21-6-2-7(22)14-5(1-11(26)19(29)20(14)30)13(6)15-8(23)3-10(25)17-16(15)9(24)4-12(27)18(17)28/h2-4,11,21-26H,1H2/t11-/m1/s1 |
| InChIKey | XQGVQKJYVBRTGJ-LLVKDONJSA-N |
| XLogP | 0.51 |
| TPSA | 189.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|