C22H16I2O8 — CID 130383939
8-iodo-6-methoxy-5-(5,6,8-trihydroxy-4-iodo-2-methoxynaphthalen-1-yl)naphthalene-1,2,4-triol (PubChem CID 130383939) has the molecular formula C22H16I2O8 and a molecular weight of 662.17 g/mol. Its IUPAC name is 8-iodo-6-methoxy-5-(5,6,8-trihydroxy-4-iodo-2-methoxynaphthalen-1-yl)naphthalene-1,2,4-triol.
| Compound Name | 8-iodo-6-methoxy-5-(5,6,8-trihydroxy-4-iodo-2-methoxynaphthalen-1-yl)naphthalene-1,2,4-triol |
|---|---|
| PubChem CID | 130383939 |
| Molecular Formula | C22H16I2O8 |
| Molecular Weight | 662.17 g/mol |
| Exact Mass | 661.89 |
| IUPAC Name | 8-iodo-6-methoxy-5-(5,6,8-trihydroxy-4-iodo-2-methoxynaphthalen-1-yl)naphthalene-1,2,4-triol |
| SMILES | COc1cc(I)c2c(O)c(O)cc(O)c2c1-c1c(OC)cc(I)c2c(O)c(O)cc(O)c12 |
| InChI | InChI=1S/C22H16I2O8/c1-31-13-3-7(23)15-17(9(25)5-11(27)21(15)29)19(13)20-14(32-2)4-8(24)16-18(20)10(26)6-12(28)22(16)30/h3-6,25-30H,1-2H3 |
| InChIKey | WKCHGEZAJCWSBI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.17 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|