C19H13BrF3NO — CID 130385242
(2S,3R)-8-bromo-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromen-2-amine (PubChem CID 130385242) has the molecular formula C19H13BrF3NO and a molecular weight of 408.22 g/mol. Its IUPAC name is (2S,3R)-8-bromo-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromen-2-amine.
| Compound Name | (2S,3R)-8-bromo-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromen-2-amine |
|---|---|
| PubChem CID | 130385242 |
| Molecular Formula | C19H13BrF3NO |
| Molecular Weight | 408.22 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | (2S,3R)-8-bromo-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromen-2-amine |
| SMILES | N[C@H]1Cc2c(ccc3cc(Br)ccc23)O[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H13BrF3NO/c20-10-2-3-11-9(5-10)1-4-18-12(11)7-17(24)19(25-18)13-6-15(22)16(23)8-14(13)21/h1-6,8,17,19H,7,24H2/t17-,19+/m0/s1 |
| InChIKey | RMHQXDTZYSOTEG-PKOBYXMFSA-N |
| XLogP | 5.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.22 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|