C15H12F3NO2 — CID 130385268
3-amino-2-(2,4,5-trifluorophenyl)-3,4-dihydro-2H-chromen-5-ol (PubChem CID 130385268) has the molecular formula C15H12F3NO2 and a molecular weight of 295.26 g/mol. Its IUPAC name is 3-amino-2-(2,4,5-trifluorophenyl)-3,4-dihydro-2H-chromen-5-ol.
| Compound Name | 3-amino-2-(2,4,5-trifluorophenyl)-3,4-dihydro-2H-chromen-5-ol |
|---|---|
| PubChem CID | 130385268 |
| Molecular Formula | C15H12F3NO2 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 3-amino-2-(2,4,5-trifluorophenyl)-3,4-dihydro-2H-chromen-5-ol |
| SMILES | NC1Cc2c(O)cccc2OC1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C15H12F3NO2/c16-9-6-11(18)10(17)4-7(9)15-12(19)5-8-13(20)2-1-3-14(8)21-15/h1-4,6,12,15,20H,5,19H2 |
| InChIKey | PYCFPYLBPMMKMJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|