C20H17Cl2N7 — CID 130386209
1-N-[3-(2,4-dichlorophenyl)-5-(1H-imidazol-2-yl)-2-pyridinyl]-1-N'-pyrimidin-2-ylethane-1,1-diamine (PubChem CID 130386209) has the molecular formula C20H17Cl2N7 and a molecular weight of 426.31 g/mol. Its IUPAC name is 1-N-[3-(2,4-dichlorophenyl)-5-(1H-imidazol-2-yl)-2-pyridinyl]-1-N'-pyrimidin-2-ylethane-1,1-diamine.
| Compound Name | 1-N-[3-(2,4-dichlorophenyl)-5-(1H-imidazol-2-yl)-2-pyridinyl]-1-N'-pyrimidin-2-ylethane-1,1-diamine |
|---|---|
| PubChem CID | 130386209 |
| Molecular Formula | C20H17Cl2N7 |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 1-N-[3-(2,4-dichlorophenyl)-5-(1H-imidazol-2-yl)-2-pyridinyl]-1-N'-pyrimidin-2-ylethane-1,1-diamine |
| SMILES | CC(Nc1ncccn1)Nc1ncc(-c2ncc[nH]2)cc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H17Cl2N7/c1-12(29-20-25-5-2-6-26-20)28-19-16(15-4-3-14(21)10-17(15)22)9-13(11-27-19)18-23-7-8-24-18/h2-12H,1H3,(H,23,24)(H,27,28)(H,25,26,29) |
| InChIKey | CTSFVNYNCZMMIT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|