About (Z)-N-(2,3-dimethylpentyl)-2-methylhept-3-en-3-amine
(Z)-N-(2,3-dimethylpentyl)-2-methylhept-3-en-3-amine (PubChem CID 130387950) has the molecular formula C15H31N
and a molecular weight of 225.42 g/mol. Its IUPAC name is (Z)-N-(2,3-dimethylpentyl)-2-methylhept-3-en-3-amine.
Molecular Properties
| Compound Name | (Z)-N-(2,3-dimethylpentyl)-2-methylhept-3-en-3-amine |
| PubChem CID | 130387950 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | (Z)-N-(2,3-dimethylpentyl)-2-methylhept-3-en-3-amine |
| SMILES | CCC/C=C(\NCC(C)C(C)CC)C(C)C |
| InChI | InChI=1S/C15H31N/c1-7-9-10-15(12(3)4)16-11-14(6)13(5)8-2/h10,12-14,16H,7-9,11H2,1-6H3/b15-10- |
| InChIKey | AGEWLKMHKBAZAO-GDNBJRDFSA-N |
| XLogP | 4.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z)-N-(2,3-dimethylpentyl)-2-methylhept-3-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-(2,3-dimethylpentyl)-2-methylhept-3-en-3-amine?
The IUPAC name of (Z)-N-(2,3-dimethylpentyl)-2-methylhept-3-en-3-amine (CID 130387950) is (Z)-N-(2,3-dimethylpentyl)-2-methylhept-3-en-3-amine.
What is the SMILES notation for (Z)-N-(2,3-dimethylpentyl)-2-methylhept-3-en-3-amine?
The canonical SMILES for (Z)-N-(2,3-dimethylpentyl)-2-methylhept-3-en-3-amine is CCC/C=C(\NCC(C)C(C)CC)C(C)C.
What is the InChIKey of (Z)-N-(2,3-dimethylpentyl)-2-methylhept-3-en-3-amine?
The InChIKey is AGEWLKMHKBAZAO-GDNBJRDFSA-N. The full InChI is InChI=1S/C15H31N/c1-7-9-10-15(12(3)4)16-11-14(6)13(5)8-2/h10,12-14,16H,7-9,11H2,1-6H3/b15-10-.
What are the key properties of (Z)-N-(2,3-dimethylpentyl)-2-methylhept-3-en-3-amine?
(Z)-N-(2,3-dimethylpentyl)-2-methylhept-3-en-3-amine has a molecular weight of 225.42 g/mol, XLogP of 4.60, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-(2,3-dimethylpentyl)-2-methylhept-3-en-3-amine is sourced from PubChem (CID 130387950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).