C20H26F3N3O2 — CID 130387979
3,3,3-trifluoro-1-[4-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-methylpyrazol-3-yl]piperidin-1-yl]-2-hydroxy-2-methylpropan-1-one (PubChem CID 130387979) has the molecular formula C20H26F3N3O2 and a molecular weight of 397.44 g/mol. Its IUPAC name is 3,3,3-trifluoro-1-[4-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-methylpyrazol-3-yl]piperidin-1-yl]-2-hydroxy-2-methylpropan-1-one.
| Compound Name | 3,3,3-trifluoro-1-[4-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-methylpyrazol-3-yl]piperidin-1-yl]-2-hydroxy-2-methylpropan-1-one |
|---|---|
| PubChem CID | 130387979 |
| Molecular Formula | C20H26F3N3O2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 3,3,3-trifluoro-1-[4-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-methylpyrazol-3-yl]piperidin-1-yl]-2-hydroxy-2-methylpropan-1-one |
| SMILES | C=C/C=C(\C=C/C)n1nc(C)cc1C1CCN(C(=O)C(C)(O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H26F3N3O2/c1-5-7-16(8-6-2)26-17(13-14(3)24-26)15-9-11-25(12-10-15)18(27)19(4,28)20(21,22)23/h5-8,13,15,28H,1,9-12H2,2-4H3/b8-6-,16-7+ |
| InChIKey | YYWPSQCFFCFAGD-JVTGKPJRSA-N |
| XLogP | 3.81 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|