C19H39NO2 — CID 130388255
5-ethyl-N-(2-hydroxypropyl)-2,2,3,3,5,6,6-heptamethylheptanamide (PubChem CID 130388255) has the molecular formula C19H39NO2 and a molecular weight of 313.53 g/mol. Its IUPAC name is 5-ethyl-N-(2-hydroxypropyl)-2,2,3,3,5,6,6-heptamethylheptanamide.
| Compound Name | 5-ethyl-N-(2-hydroxypropyl)-2,2,3,3,5,6,6-heptamethylheptanamide |
|---|---|
| PubChem CID | 130388255 |
| Molecular Formula | C19H39NO2 |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.30 |
| IUPAC Name | 5-ethyl-N-(2-hydroxypropyl)-2,2,3,3,5,6,6-heptamethylheptanamide |
| SMILES | CCC(C)(CC(C)(C)C(C)(C)C(=O)NCC(C)O)C(C)(C)C |
| InChI | InChI=1S/C19H39NO2/c1-11-19(10,16(3,4)5)13-17(6,7)18(8,9)15(22)20-12-14(2)21/h14,21H,11-13H2,1-10H3,(H,20,22) |
| InChIKey | JQVPASKVVURUSQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |