C24H39N3O7 — CID 130388279
[(3R)-5-methoxy-4-[(2R,3R)-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[4-[[2-(hydroxyamino)acetyl]amino]cyclohexyl]carbamate (PubChem CID 130388279) has the molecular formula C24H39N3O7 and a molecular weight of 481.59 g/mol. Its IUPAC name is [(3R)-5-methoxy-4-[(2R,3R)-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[4-[[2-(hydroxyamino)acetyl]amino]cyclohexyl]carbamate.
| Compound Name | [(3R)-5-methoxy-4-[(2R,3R)-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[4-[[2-(hydroxyamino)acetyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 130388279 |
| Molecular Formula | C24H39N3O7 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | [(3R)-5-methoxy-4-[(2R,3R)-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[4-[[2-(hydroxyamino)acetyl]amino]cyclohexyl]carbamate |
| SMILES | COC1C(OC(=O)NC2CCC(NC(=O)CNO)CC2)CC[C@]2(CO2)C1C1O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C24H39N3O7/c1-14(2)4-9-17-22(33-17)20-21(31-3)18(10-11-24(20)13-32-24)34-23(29)27-16-7-5-15(6-8-16)26-19(28)12-25-30/h4,15-18,20-22,25,30H,5-13H2,1-3H3,(H,26,28)(H,27,29)/t15?,16?,17-,18?,20?,21?,22?,24+/m1/s1 |
| InChIKey | MCMQHNNIXYFDJW-ZNEATTLPSA-N |
| XLogP | 1.81 |
| TPSA | 133.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|