C17H30O4 — CID 130388308
(3R)-5,6-dimethoxy-4-[(2R,3R)-2-methyl-3-(3-methylbutyl)oxiran-2-yl]-1-oxaspiro[2.5]octane (PubChem CID 130388308) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is (3R)-5,6-dimethoxy-4-[(2R,3R)-2-methyl-3-(3-methylbutyl)oxiran-2-yl]-1-oxaspiro[2.5]octane.
| Compound Name | (3R)-5,6-dimethoxy-4-[(2R,3R)-2-methyl-3-(3-methylbutyl)oxiran-2-yl]-1-oxaspiro[2.5]octane |
|---|---|
| PubChem CID | 130388308 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | (3R)-5,6-dimethoxy-4-[(2R,3R)-2-methyl-3-(3-methylbutyl)oxiran-2-yl]-1-oxaspiro[2.5]octane |
| SMILES | COC1CC[C@]2(CO2)C(C2(C)O[C@@H]2CCC(C)C)C1OC |
| InChI | InChI=1S/C17H30O4/c1-11(2)6-7-13-16(3,21-13)15-14(19-5)12(18-4)8-9-17(15)10-20-17/h11-15H,6-10H2,1-5H3/t12?,13-,14?,15?,16?,17+/m1/s1 |
| InChIKey | SEBVAMXHYKLXGM-PXFIZVRLSA-N |
| XLogP | 2.79 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|