C12H19NO2 — CID 130388429
methyl (2E,4Z)-2,6,6-trimethyl-5-(methylideneamino)hepta-2,4-dienoate (PubChem CID 130388429) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is methyl (2E,4Z)-2,6,6-trimethyl-5-(methylideneamino)hepta-2,4-dienoate.
| Compound Name | methyl (2E,4Z)-2,6,6-trimethyl-5-(methylideneamino)hepta-2,4-dienoate |
|---|---|
| PubChem CID | 130388429 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | methyl (2E,4Z)-2,6,6-trimethyl-5-(methylideneamino)hepta-2,4-dienoate |
| SMILES | C=N/C(=C\C=C(/C)C(=O)OC)C(C)(C)C |
| InChI | InChI=1S/C12H19NO2/c1-9(11(14)15-6)7-8-10(13-5)12(2,3)4/h7-8H,5H2,1-4,6H3/b9-7+,10-8- |
| InChIKey | PLKFUKWITIVCOU-ZWOQCJTASA-N |
| XLogP | 2.74 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|