C12H18O8S — CID 130388610
[(3S,6R)-3,5-diacetyloxy-6-methoxy-1,4-oxathian-2-yl]methyl acetate (PubChem CID 130388610) has the molecular formula C12H18O8S and a molecular weight of 322.34 g/mol. Its IUPAC name is [(3S,6R)-3,5-diacetyloxy-6-methoxy-1,4-oxathian-2-yl]methyl acetate.
| Compound Name | [(3S,6R)-3,5-diacetyloxy-6-methoxy-1,4-oxathian-2-yl]methyl acetate |
|---|---|
| PubChem CID | 130388610 |
| Molecular Formula | C12H18O8S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | [(3S,6R)-3,5-diacetyloxy-6-methoxy-1,4-oxathian-2-yl]methyl acetate |
| SMILES | CO[C@@H]1OC(COC(C)=O)[C@@H](OC(C)=O)SC1OC(C)=O |
| InChI | InChI=1S/C12H18O8S/c1-6(13)17-5-9-11(18-7(2)14)21-12(19-8(3)15)10(16-4)20-9/h9-12H,5H2,1-4H3/t9?,10-,11+,12?/m1/s1 |
| InChIKey | PBAACGVYOVLEDL-UPOSSJBDSA-N |
| XLogP | 0.43 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|