C20H27N — CID 130388899
1-[3-[3-methyl-2-(3-methylcyclohexa-2,4-dien-1-yl)but-3-enyl]cyclohexa-1,3-dien-1-yl]ethanimine (PubChem CID 130388899) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is 1-[3-[3-methyl-2-(3-methylcyclohexa-2,4-dien-1-yl)but-3-enyl]cyclohexa-1,3-dien-1-yl]ethanimine.
| Compound Name | 1-[3-[3-methyl-2-(3-methylcyclohexa-2,4-dien-1-yl)but-3-enyl]cyclohexa-1,3-dien-1-yl]ethanimine |
|---|---|
| PubChem CID | 130388899 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 1-[3-[3-methyl-2-(3-methylcyclohexa-2,4-dien-1-yl)but-3-enyl]cyclohexa-1,3-dien-1-yl]ethanimine |
| SMILES | [H]/N=C(\C)C1=CC(CC(C(=C)C)C2C=C(C)C=CC2)=CCC1 |
| InChI | InChI=1S/C20H27N/c1-14(2)20(19-10-5-7-15(3)11-19)13-17-8-6-9-18(12-17)16(4)21/h5,7-8,11-12,19-21H,1,6,9-10,13H2,2-4H3/b21-16+ |
| InChIKey | HVYTVXALZVPWKX-LTGZKZEYSA-N |
| XLogP | 5.78 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|