About N'-[2-methyl-4,5-bis[(Z)-prop-1-enyl]thiophen-3-yl]methanimidamide
N'-[2-methyl-4,5-bis[(Z)-prop-1-enyl]thiophen-3-yl]methanimidamide (PubChem CID 130388909) has the molecular formula C12H16N2S
and a molecular weight of 220.34 g/mol. Its IUPAC name is N'-[2-methyl-4,5-bis[(Z)-prop-1-enyl]thiophen-3-yl]methanimidamide.
Molecular Properties
| Compound Name | N'-[2-methyl-4,5-bis[(Z)-prop-1-enyl]thiophen-3-yl]methanimidamide |
| PubChem CID | 130388909 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N'-[2-methyl-4,5-bis[(Z)-prop-1-enyl]thiophen-3-yl]methanimidamide |
| SMILES | C/C=C\c1sc(C)c(/N=C/N)c1/C=C\C |
| InChI | InChI=1S/C12H16N2S/c1-4-6-10-11(7-5-2)15-9(3)12(10)14-8-13/h4-8H,1-3H3,(H2,13,14)/b6-4-,7-5- |
| InChIKey | SHKZVJCIYDPRRG-PEPZGXQESA-N |
| XLogP | 3.74 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-methyl-4,5-bis[(Z)-prop-1-enyl]thiophen-3-yl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-methyl-4,5-bis[(Z)-prop-1-enyl]thiophen-3-yl]methanimidamide?
The IUPAC name of N'-[2-methyl-4,5-bis[(Z)-prop-1-enyl]thiophen-3-yl]methanimidamide (CID 130388909) is N'-[2-methyl-4,5-bis[(Z)-prop-1-enyl]thiophen-3-yl]methanimidamide.
What is the SMILES notation for N'-[2-methyl-4,5-bis[(Z)-prop-1-enyl]thiophen-3-yl]methanimidamide?
The canonical SMILES for N'-[2-methyl-4,5-bis[(Z)-prop-1-enyl]thiophen-3-yl]methanimidamide is C/C=C\c1sc(C)c(/N=C/N)c1/C=C\C.
What is the InChIKey of N'-[2-methyl-4,5-bis[(Z)-prop-1-enyl]thiophen-3-yl]methanimidamide?
The InChIKey is SHKZVJCIYDPRRG-PEPZGXQESA-N. The full InChI is InChI=1S/C12H16N2S/c1-4-6-10-11(7-5-2)15-9(3)12(10)14-8-13/h4-8H,1-3H3,(H2,13,14)/b6-4-,7-5-.
What are the key properties of N'-[2-methyl-4,5-bis[(Z)-prop-1-enyl]thiophen-3-yl]methanimidamide?
N'-[2-methyl-4,5-bis[(Z)-prop-1-enyl]thiophen-3-yl]methanimidamide has a molecular weight of 220.34 g/mol, XLogP of 3.74, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-methyl-4,5-bis[(Z)-prop-1-enyl]thiophen-3-yl]methanimidamide is sourced from PubChem (CID 130388909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).