C29H37FN4O4 — CID 130389123
3-[7-[[6-fluoro-4-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]cyclohexa-1,5-dien-1-yl]methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 130389123) has the molecular formula C29H37FN4O4 and a molecular weight of 524.64 g/mol. Its IUPAC name is 3-[7-[[6-fluoro-4-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]cyclohexa-1,5-dien-1-yl]methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[6-fluoro-4-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]cyclohexa-1,5-dien-1-yl]methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 130389123 |
| Molecular Formula | C29H37FN4O4 |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | 3-[7-[[6-fluoro-4-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]cyclohexa-1,5-dien-1-yl]methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC1(C)CN(CC2C=C(F)C(CNc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)=CC2)CC(C)(C)O1 |
| InChI | InChI=1S/C29H37FN4O4/c1-28(2)16-33(17-29(3,4)38-28)14-18-8-9-19(22(30)12-18)13-31-23-7-5-6-20-21(23)15-34(27(20)37)24-10-11-25(35)32-26(24)36/h5-7,9,12,18,24,31H,8,10-11,13-17H2,1-4H3,(H,32,35,36) |
| InChIKey | RUYGXRBCZFFEDX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|