C21H29F2N3 — CID 130389633
(3Z)-3-N-(2,2-difluoroethyl)-2-N-[(2E)-3-ethenyl-2-prop-2-enimidoylhexa-2,4,5-trienyl]-2-N,5-dimethylhexa-3,5-diene-2,3-diamine (PubChem CID 130389633) has the molecular formula C21H29F2N3 and a molecular weight of 361.48 g/mol. Its IUPAC name is (3Z)-3-N-(2,2-difluoroethyl)-2-N-[(2E)-3-ethenyl-2-prop-2-enimidoylhexa-2,4,5-trienyl]-2-N,5-dimethylhexa-3,5-diene-2,3-diamine.
| Compound Name | (3Z)-3-N-(2,2-difluoroethyl)-2-N-[(2E)-3-ethenyl-2-prop-2-enimidoylhexa-2,4,5-trienyl]-2-N,5-dimethylhexa-3,5-diene-2,3-diamine |
|---|---|
| PubChem CID | 130389633 |
| Molecular Formula | C21H29F2N3 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | (3Z)-3-N-(2,2-difluoroethyl)-2-N-[(2E)-3-ethenyl-2-prop-2-enimidoylhexa-2,4,5-trienyl]-2-N,5-dimethylhexa-3,5-diene-2,3-diamine |
| SMILES | [H]/N=C(C=C)/C(CN(C)C(C)/C(=C/C(=C)C)NCC(F)F)=C(\C=C)C=C=C |
| InChI | InChI=1S/C21H29F2N3/c1-8-11-17(9-2)18(19(24)10-3)14-26(7)16(6)20(12-15(4)5)25-13-21(22)23/h9-12,16,21,24-25H,1-4,13-14H2,5-7H3/b18-17+,20-12-,24-19+ |
| InChIKey | AXQMMPSOAIXYRQ-JUWJGKDCSA-N |
| XLogP | 4.65 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|