C18H29N3 — CID 130390021
(3Z,5Z)-2-N-[(2-ethenyl-5,5-dimethylcyclopenta-1,3-dien-1-yl)methyl]-5-methylhepta-3,5-diene-2,3,6-triamine (PubChem CID 130390021) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is (3Z,5Z)-2-N-[(2-ethenyl-5,5-dimethylcyclopenta-1,3-dien-1-yl)methyl]-5-methylhepta-3,5-diene-2,3,6-triamine.
| Compound Name | (3Z,5Z)-2-N-[(2-ethenyl-5,5-dimethylcyclopenta-1,3-dien-1-yl)methyl]-5-methylhepta-3,5-diene-2,3,6-triamine |
|---|---|
| PubChem CID | 130390021 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | (3Z,5Z)-2-N-[(2-ethenyl-5,5-dimethylcyclopenta-1,3-dien-1-yl)methyl]-5-methylhepta-3,5-diene-2,3,6-triamine |
| SMILES | C=CC1=C(CNC(C)/C(N)=C/C(C)=C(/C)N)C(C)(C)C=C1 |
| InChI | InChI=1S/C18H29N3/c1-7-15-8-9-18(5,6)16(15)11-21-14(4)17(20)10-12(2)13(3)19/h7-10,14,21H,1,11,19-20H2,2-6H3/b13-12-,17-10- |
| InChIKey | WQFAIEAIRZWLHG-ZLTRIVSTSA-N |
| XLogP | 3.14 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|