C14H22F3N — CID 130390089
(2Z)-4-methyl-2-propan-2-yl-N-(3,4,4-trifluoro-3-methylbutyl)penta-2,4-dien-1-imine (PubChem CID 130390089) has the molecular formula C14H22F3N and a molecular weight of 261.33 g/mol. Its IUPAC name is (2Z)-4-methyl-2-propan-2-yl-N-(3,4,4-trifluoro-3-methylbutyl)penta-2,4-dien-1-imine.
| Compound Name | (2Z)-4-methyl-2-propan-2-yl-N-(3,4,4-trifluoro-3-methylbutyl)penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 130390089 |
| Molecular Formula | C14H22F3N |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (2Z)-4-methyl-2-propan-2-yl-N-(3,4,4-trifluoro-3-methylbutyl)penta-2,4-dien-1-imine |
| SMILES | C=C(C)/C=C(\C=N\CCC(C)(F)C(F)F)C(C)C |
| InChI | InChI=1S/C14H22F3N/c1-10(2)8-12(11(3)4)9-18-7-6-14(5,17)13(15)16/h8-9,11,13H,1,6-7H2,2-5H3/b12-8+,18-9+ |
| InChIKey | MBDVUKLICPOEFX-KJXRKRIBSA-N |
| XLogP | 4.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|