About (3Z)-6-(2,2-difluoroethoxy)-3-methylhexa-1,3-diene
(3Z)-6-(2,2-difluoroethoxy)-3-methylhexa-1,3-diene (PubChem CID 130390103) has the molecular formula C9H14F2O
and a molecular weight of 176.21 g/mol. Its IUPAC name is (3Z)-6-(2,2-difluoroethoxy)-3-methylhexa-1,3-diene.
Molecular Properties
| Compound Name | (3Z)-6-(2,2-difluoroethoxy)-3-methylhexa-1,3-diene |
| PubChem CID | 130390103 |
| Molecular Formula | C9H14F2O |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (3Z)-6-(2,2-difluoroethoxy)-3-methylhexa-1,3-diene |
| SMILES | C=C/C(C)=C\CCOCC(F)F |
| InChI | InChI=1S/C9H14F2O/c1-3-8(2)5-4-6-12-7-9(10)11/h3,5,9H,1,4,6-7H2,2H3/b8-5- |
| InChIKey | MFTXUMZMEVVDJA-YVMONPNESA-N |
| XLogP | 2.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-6-(2,2-difluoroethoxy)-3-methylhexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-6-(2,2-difluoroethoxy)-3-methylhexa-1,3-diene?
The IUPAC name of (3Z)-6-(2,2-difluoroethoxy)-3-methylhexa-1,3-diene (CID 130390103) is (3Z)-6-(2,2-difluoroethoxy)-3-methylhexa-1,3-diene.
What is the SMILES notation for (3Z)-6-(2,2-difluoroethoxy)-3-methylhexa-1,3-diene?
The canonical SMILES for (3Z)-6-(2,2-difluoroethoxy)-3-methylhexa-1,3-diene is C=C/C(C)=C\CCOCC(F)F.
What is the InChIKey of (3Z)-6-(2,2-difluoroethoxy)-3-methylhexa-1,3-diene?
The InChIKey is MFTXUMZMEVVDJA-YVMONPNESA-N. The full InChI is InChI=1S/C9H14F2O/c1-3-8(2)5-4-6-12-7-9(10)11/h3,5,9H,1,4,6-7H2,2H3/b8-5-.
What are the key properties of (3Z)-6-(2,2-difluoroethoxy)-3-methylhexa-1,3-diene?
(3Z)-6-(2,2-difluoroethoxy)-3-methylhexa-1,3-diene has a molecular weight of 176.21 g/mol, XLogP of 2.79, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-6-(2,2-difluoroethoxy)-3-methylhexa-1,3-diene is sourced from PubChem (CID 130390103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).