C23H37N5 — CID 130390315
2-N-[1-[1-(6-ethenyl-1,2-dihydropyridin-3-yl)ethyl-methylamino]ethyl]-2-methyl-2-N-(2-methylidenebut-3-enyl)-3-N-[(Z)-prop-1-enyl]aziridine-2,3-diamine (PubChem CID 130390315) has the molecular formula C23H37N5 and a molecular weight of 383.58 g/mol. Its IUPAC name is 2-N-[1-[1-(6-ethenyl-1,2-dihydropyridin-3-yl)ethyl-methylamino]ethyl]-2-methyl-2-N-(2-methylidenebut-3-enyl)-3-N-[(Z)-prop-1-enyl]aziridine-2,3-diamine.
| Compound Name | 2-N-[1-[1-(6-ethenyl-1,2-dihydropyridin-3-yl)ethyl-methylamino]ethyl]-2-methyl-2-N-(2-methylidenebut-3-enyl)-3-N-[(Z)-prop-1-enyl]aziridine-2,3-diamine |
|---|---|
| PubChem CID | 130390315 |
| Molecular Formula | C23H37N5 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.30 |
| IUPAC Name | 2-N-[1-[1-(6-ethenyl-1,2-dihydropyridin-3-yl)ethyl-methylamino]ethyl]-2-methyl-2-N-(2-methylidenebut-3-enyl)-3-N-[(Z)-prop-1-enyl]aziridine-2,3-diamine |
| SMILES | C=CC(=C)CN(C(C)N(C)C(C)C1=CC=C(C=C)NC1)C1(C)NC1N/C=C\C |
| InChI | InChI=1S/C23H37N5/c1-9-14-24-22-23(7,26-22)28(16-17(4)10-2)19(6)27(8)18(5)20-12-13-21(11-3)25-15-20/h9-14,18-19,22,24-26H,2-4,15-16H2,1,5-8H3/b14-9- |
| InChIKey | WJMZVMQVNXHCAP-ZROIWOOFSA-N |
| XLogP | 3.07 |
| TPSA | 52.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|