About (2E,4Z)-N-ethyl-2-methylhexa-2,4-dien-1-imine
(2E,4Z)-N-ethyl-2-methylhexa-2,4-dien-1-imine (PubChem CID 130390391) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is (2E,4Z)-N-ethyl-2-methylhexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | (2E,4Z)-N-ethyl-2-methylhexa-2,4-dien-1-imine |
| PubChem CID | 130390391 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | (2E,4Z)-N-ethyl-2-methylhexa-2,4-dien-1-imine |
| SMILES | C/C=C\C=C(C)\C=N\CC |
| InChI | InChI=1S/C9H15N/c1-4-6-7-9(3)8-10-5-2/h4,6-8H,5H2,1-3H3/b6-4-,9-7+,10-8+ |
| InChIKey | AQGGJSPLHMFTFD-DILYWIELSA-N |
| XLogP | 2.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-N-ethyl-2-methylhexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-N-ethyl-2-methylhexa-2,4-dien-1-imine?
The IUPAC name of (2E,4Z)-N-ethyl-2-methylhexa-2,4-dien-1-imine (CID 130390391) is (2E,4Z)-N-ethyl-2-methylhexa-2,4-dien-1-imine.
What is the SMILES notation for (2E,4Z)-N-ethyl-2-methylhexa-2,4-dien-1-imine?
The canonical SMILES for (2E,4Z)-N-ethyl-2-methylhexa-2,4-dien-1-imine is C/C=C\C=C(C)\C=N\CC.
What is the InChIKey of (2E,4Z)-N-ethyl-2-methylhexa-2,4-dien-1-imine?
The InChIKey is AQGGJSPLHMFTFD-DILYWIELSA-N. The full InChI is InChI=1S/C9H15N/c1-4-6-7-9(3)8-10-5-2/h4,6-8H,5H2,1-3H3/b6-4-,9-7+,10-8+.
What are the key properties of (2E,4Z)-N-ethyl-2-methylhexa-2,4-dien-1-imine?
(2E,4Z)-N-ethyl-2-methylhexa-2,4-dien-1-imine has a molecular weight of 137.23 g/mol, XLogP of 2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-N-ethyl-2-methylhexa-2,4-dien-1-imine is sourced from PubChem (CID 130390391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).