About (Z)-5,5,6-trimethyl-3-prop-1-en-2-ylsulfanylhept-2-ene
(Z)-5,5,6-trimethyl-3-prop-1-en-2-ylsulfanylhept-2-ene (PubChem CID 130390469) has the molecular formula C13H24S
and a molecular weight of 212.40 g/mol. Its IUPAC name is (Z)-5,5,6-trimethyl-3-prop-1-en-2-ylsulfanylhept-2-ene.
Molecular Properties
| Compound Name | (Z)-5,5,6-trimethyl-3-prop-1-en-2-ylsulfanylhept-2-ene |
| PubChem CID | 130390469 |
| Molecular Formula | C13H24S |
| Molecular Weight | 212.40 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | (Z)-5,5,6-trimethyl-3-prop-1-en-2-ylsulfanylhept-2-ene |
| SMILES | C=C(C)S/C(=C\C)CC(C)(C)C(C)C |
| InChI | InChI=1S/C13H24S/c1-8-12(14-11(4)5)9-13(6,7)10(2)3/h8,10H,4,9H2,1-3,5-7H3/b12-8- |
| InChIKey | RQMHNFPLASBHLL-WQLSENKSSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 212.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z)-5,5,6-trimethyl-3-prop-1-en-2-ylsulfanylhept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5,5,6-trimethyl-3-prop-1-en-2-ylsulfanylhept-2-ene?
The IUPAC name of (Z)-5,5,6-trimethyl-3-prop-1-en-2-ylsulfanylhept-2-ene (CID 130390469) is (Z)-5,5,6-trimethyl-3-prop-1-en-2-ylsulfanylhept-2-ene.
What is the SMILES notation for (Z)-5,5,6-trimethyl-3-prop-1-en-2-ylsulfanylhept-2-ene?
The canonical SMILES for (Z)-5,5,6-trimethyl-3-prop-1-en-2-ylsulfanylhept-2-ene is C=C(C)S/C(=C\C)CC(C)(C)C(C)C.
What is the InChIKey of (Z)-5,5,6-trimethyl-3-prop-1-en-2-ylsulfanylhept-2-ene?
The InChIKey is RQMHNFPLASBHLL-WQLSENKSSA-N. The full InChI is InChI=1S/C13H24S/c1-8-12(14-11(4)5)9-13(6,7)10(2)3/h8,10H,4,9H2,1-3,5-7H3/b12-8-.
What are the key properties of (Z)-5,5,6-trimethyl-3-prop-1-en-2-ylsulfanylhept-2-ene?
(Z)-5,5,6-trimethyl-3-prop-1-en-2-ylsulfanylhept-2-ene has a molecular weight of 212.40 g/mol, XLogP of 5.23, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5,5,6-trimethyl-3-prop-1-en-2-ylsulfanylhept-2-ene is sourced from PubChem (CID 130390469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).