About (1Z)-3-methanimidoyl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)buta-1,3-dien-1-ol
(1Z)-3-methanimidoyl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)buta-1,3-dien-1-ol (PubChem CID 130390598) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is (1Z)-3-methanimidoyl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)buta-1,3-dien-1-ol.
Molecular Properties
| Compound Name | (1Z)-3-methanimidoyl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)buta-1,3-dien-1-ol |
| PubChem CID | 130390598 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (1Z)-3-methanimidoyl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)buta-1,3-dien-1-ol |
| SMILES | [H]/N=C/C(=C)/C=C(\O)C1C=CC(C(C)C)=CC1 |
| InChI | InChI=1S/C14H19NO/c1-10(2)12-4-6-13(7-5-12)14(16)8-11(3)9-15/h4-6,8-10,13,15-16H,3,7H2,1-2H3/b14-8-,15-9+ |
| InChIKey | LFMBHYJPUUXKEA-DJJIWSAGSA-N |
| XLogP | 3.79 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-3-methanimidoyl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)buta-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-3-methanimidoyl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)buta-1,3-dien-1-ol?
The IUPAC name of (1Z)-3-methanimidoyl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)buta-1,3-dien-1-ol (CID 130390598) is (1Z)-3-methanimidoyl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)buta-1,3-dien-1-ol.
What is the SMILES notation for (1Z)-3-methanimidoyl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)buta-1,3-dien-1-ol?
The canonical SMILES for (1Z)-3-methanimidoyl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)buta-1,3-dien-1-ol is [H]/N=C/C(=C)/C=C(\O)C1C=CC(C(C)C)=CC1.
What is the InChIKey of (1Z)-3-methanimidoyl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)buta-1,3-dien-1-ol?
The InChIKey is LFMBHYJPUUXKEA-DJJIWSAGSA-N. The full InChI is InChI=1S/C14H19NO/c1-10(2)12-4-6-13(7-5-12)14(16)8-11(3)9-15/h4-6,8-10,13,15-16H,3,7H2,1-2H3/b14-8-,15-9+.
What are the key properties of (1Z)-3-methanimidoyl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)buta-1,3-dien-1-ol?
(1Z)-3-methanimidoyl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)buta-1,3-dien-1-ol has a molecular weight of 217.31 g/mol, XLogP of 3.79, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-3-methanimidoyl-1-(4-propan-2-ylcyclohexa-2,4-dien-1-yl)buta-1,3-dien-1-ol is sourced from PubChem (CID 130390598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).