C13H16F3N3S — CID 130390600
N-methyl-1-[2-[(1E,3Z)-6,6,6-trifluoro-1-(methylideneamino)hexa-1,3-dien-2-yl]-1,3-thiazol-5-yl]ethanamine (PubChem CID 130390600) has the molecular formula C13H16F3N3S and a molecular weight of 303.35 g/mol. Its IUPAC name is N-methyl-1-[2-[(1E,3Z)-6,6,6-trifluoro-1-(methylideneamino)hexa-1,3-dien-2-yl]-1,3-thiazol-5-yl]ethanamine.
| Compound Name | N-methyl-1-[2-[(1E,3Z)-6,6,6-trifluoro-1-(methylideneamino)hexa-1,3-dien-2-yl]-1,3-thiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 130390600 |
| Molecular Formula | C13H16F3N3S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-methyl-1-[2-[(1E,3Z)-6,6,6-trifluoro-1-(methylideneamino)hexa-1,3-dien-2-yl]-1,3-thiazol-5-yl]ethanamine |
| SMILES | C=N/C=C(\C=C/CC(F)(F)F)c1ncc(C(C)NC)s1 |
| InChI | InChI=1S/C13H16F3N3S/c1-9(18-3)11-8-19-12(20-11)10(7-17-2)5-4-6-13(14,15)16/h4-5,7-9,18H,2,6H2,1,3H3/b5-4-,10-7+ |
| InChIKey | OFOAPGCRQCDPJB-DOIONKORSA-N |
| XLogP | 3.97 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|