C18H30FN — CID 130390669
N-[2-[(1Z,4Z)-5-ethyl-2-(fluoromethyl)cyclodeca-1,4,6-trien-1-yl]ethyl]propan-1-amine (PubChem CID 130390669) has the molecular formula C18H30FN and a molecular weight of 279.44 g/mol. Its IUPAC name is N-[2-[(1Z,4Z)-5-ethyl-2-(fluoromethyl)cyclodeca-1,4,6-trien-1-yl]ethyl]propan-1-amine.
| Compound Name | N-[2-[(1Z,4Z)-5-ethyl-2-(fluoromethyl)cyclodeca-1,4,6-trien-1-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 130390669 |
| Molecular Formula | C18H30FN |
| Molecular Weight | 279.44 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | N-[2-[(1Z,4Z)-5-ethyl-2-(fluoromethyl)cyclodeca-1,4,6-trien-1-yl]ethyl]propan-1-amine |
| SMILES | CCCNCC/C1=C(\CF)C/C=C(/CC)C=CCCC1 |
| InChI | InChI=1S/C18H30FN/c1-3-13-20-14-12-17-9-7-5-6-8-16(4-2)10-11-18(17)15-19/h6,8,10,20H,3-5,7,9,11-15H2,1-2H3/b8-6?,16-10-,18-17- |
| InChIKey | ZVOUMXUDVXRDMZ-KGFLKVOCSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|