C12H20N2 — CID 130390686
2-tert-butyl-4,4,6-trimethyl-1,3-diazepine (PubChem CID 130390686) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 2-tert-butyl-4,4,6-trimethyl-1,3-diazepine.
| Compound Name | 2-tert-butyl-4,4,6-trimethyl-1,3-diazepine |
|---|---|
| PubChem CID | 130390686 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2-tert-butyl-4,4,6-trimethyl-1,3-diazepine |
| SMILES | CC1=CC(C)(C)N=C(C(C)(C)C)N=C1 |
| InChI | InChI=1S/C12H20N2/c1-9-7-12(5,6)14-10(13-8-9)11(2,3)4/h7-8H,1-6H3 |
| InChIKey | YCKLXCUHNXXGRL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |