About (E)-3-amino-N-[2-(3,4-difluorophenyl)phenyl]-2-(prop-2-enylideneamino)but-2-enamide
(E)-3-amino-N-[2-(3,4-difluorophenyl)phenyl]-2-(prop-2-enylideneamino)but-2-enamide (PubChem CID 130390701) has the molecular formula C19H17F2N3O
and a molecular weight of 341.36 g/mol. Its IUPAC name is (E)-3-amino-N-[2-(3,4-difluorophenyl)phenyl]-2-(prop-2-enylideneamino)but-2-enamide.
Molecular Properties
| Compound Name | (E)-3-amino-N-[2-(3,4-difluorophenyl)phenyl]-2-(prop-2-enylideneamino)but-2-enamide |
| PubChem CID | 130390701 |
| Molecular Formula | C19H17F2N3O |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (E)-3-amino-N-[2-(3,4-difluorophenyl)phenyl]-2-(prop-2-enylideneamino)but-2-enamide |
| SMILES | C=C/C=N/C(C(=O)Nc1ccccc1-c1ccc(F)c(F)c1)=C(\C)N |
| InChI | InChI=1S/C19H17F2N3O/c1-3-10-23-18(12(2)22)19(25)24-17-7-5-4-6-14(17)13-8-9-15(20)16(21)11-13/h3-11H,1,22H2,2H3,(H,24,25)/b18-12+,23-10+ |
| InChIKey | VLLYWAWXVFWXGE-REQFAKIXSA-N |
| XLogP | 4.02 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-amino-N-[2-(3,4-difluorophenyl)phenyl]-2-(prop-2-enylideneamino)but-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-amino-N-[2-(3,4-difluorophenyl)phenyl]-2-(prop-2-enylideneamino)but-2-enamide?
The IUPAC name of (E)-3-amino-N-[2-(3,4-difluorophenyl)phenyl]-2-(prop-2-enylideneamino)but-2-enamide (CID 130390701) is (E)-3-amino-N-[2-(3,4-difluorophenyl)phenyl]-2-(prop-2-enylideneamino)but-2-enamide.
What is the SMILES notation for (E)-3-amino-N-[2-(3,4-difluorophenyl)phenyl]-2-(prop-2-enylideneamino)but-2-enamide?
The canonical SMILES for (E)-3-amino-N-[2-(3,4-difluorophenyl)phenyl]-2-(prop-2-enylideneamino)but-2-enamide is C=C/C=N/C(C(=O)Nc1ccccc1-c1ccc(F)c(F)c1)=C(\C)N.
What is the InChIKey of (E)-3-amino-N-[2-(3,4-difluorophenyl)phenyl]-2-(prop-2-enylideneamino)but-2-enamide?
The InChIKey is VLLYWAWXVFWXGE-REQFAKIXSA-N. The full InChI is InChI=1S/C19H17F2N3O/c1-3-10-23-18(12(2)22)19(25)24-17-7-5-4-6-14(17)13-8-9-15(20)16(21)11-13/h3-11H,1,22H2,2H3,(H,24,25)/b18-12+,23-10+.
What are the key properties of (E)-3-amino-N-[2-(3,4-difluorophenyl)phenyl]-2-(prop-2-enylideneamino)but-2-enamide?
(E)-3-amino-N-[2-(3,4-difluorophenyl)phenyl]-2-(prop-2-enylideneamino)but-2-enamide has a molecular weight of 341.36 g/mol, XLogP of 4.02, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-amino-N-[2-(3,4-difluorophenyl)phenyl]-2-(prop-2-enylideneamino)but-2-enamide is sourced from PubChem (CID 130390701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).