C13H22FN — CID 130390736
(3Z,5E,8Z)-2-fluoro-2,6,7-trimethyldeca-3,5,8-trien-3-amine (PubChem CID 130390736) has the molecular formula C13H22FN and a molecular weight of 211.32 g/mol. Its IUPAC name is (3Z,5E,8Z)-2-fluoro-2,6,7-trimethyldeca-3,5,8-trien-3-amine.
| Compound Name | (3Z,5E,8Z)-2-fluoro-2,6,7-trimethyldeca-3,5,8-trien-3-amine |
|---|---|
| PubChem CID | 130390736 |
| Molecular Formula | C13H22FN |
| Molecular Weight | 211.32 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | (3Z,5E,8Z)-2-fluoro-2,6,7-trimethyldeca-3,5,8-trien-3-amine |
| SMILES | C/C=C\C(C)/C(C)=C/C=C(\N)C(C)(C)F |
| InChI | InChI=1S/C13H22FN/c1-6-7-10(2)11(3)8-9-12(15)13(4,5)14/h6-10H,15H2,1-5H3/b7-6-,11-8+,12-9- |
| InChIKey | PYJAQHRFIKKBOG-SVYHAQGUSA-N |
| XLogP | 3.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|