C30H45N5O5S — CID 130390965
[(2S)-2-[[6,6-dimethyl-3-[[1-(trimethyl-λ4-sulfanyl)cyclobutanecarbonyl]amino]-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carbonyl]amino]-2-phenylethoxy]methyl 2,2-dimethylpropanoate (PubChem CID 130390965) has the molecular formula C30H45N5O5S and a molecular weight of 587.79 g/mol. Its IUPAC name is [(2S)-2-[[6,6-dimethyl-3-[[1-(trimethyl-λ4-sulfanyl)cyclobutanecarbonyl]amino]-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carbonyl]amino]-2-phenylethoxy]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2S)-2-[[6,6-dimethyl-3-[[1-(trimethyl-λ4-sulfanyl)cyclobutanecarbonyl]amino]-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carbonyl]amino]-2-phenylethoxy]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 130390965 |
| Molecular Formula | C30H45N5O5S |
| Molecular Weight | 587.79 g/mol |
| Exact Mass | 587.31 |
| IUPAC Name | [(2S)-2-[[6,6-dimethyl-3-[[1-(trimethyl-λ4-sulfanyl)cyclobutanecarbonyl]amino]-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carbonyl]amino]-2-phenylethoxy]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOC[C@@H](NC(=O)N1Cc2c(NC(=O)C3(S(C)(C)C)CCC3)n[nH]c2C1(C)C)c1ccccc1 |
| InChI | InChI=1S/C30H45N5O5S/c1-28(2,3)26(37)40-19-39-18-22(20-13-10-9-11-14-20)31-27(38)35-17-21-23(29(35,4)5)33-34-24(21)32-25(36)30(15-12-16-30)41(6,7)8/h9-11,13-14,22H,12,15-19H2,1-8H3,(H,31,38)(H2,32,33,34,36)/t22-/m1/s1 |
| InChIKey | ZBUSZRAAVURULP-JOCHJYFZSA-N |
| XLogP | 5.03 |
| TPSA | 125.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.79 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|