C20H22O — CID 130391018
2,4-bis(cyclohexa-1,3-dien-1-ylmethyl)phenol (PubChem CID 130391018) has the molecular formula C20H22O and a molecular weight of 278.39 g/mol. Its IUPAC name is 2,4-bis(cyclohexa-1,3-dien-1-ylmethyl)phenol.
| Compound Name | 2,4-bis(cyclohexa-1,3-dien-1-ylmethyl)phenol |
|---|---|
| PubChem CID | 130391018 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2,4-bis(cyclohexa-1,3-dien-1-ylmethyl)phenol |
| SMILES | Oc1ccc(CC2=CC=CCC2)cc1CC1=CC=CCC1 |
| InChI | InChI=1S/C20H22O/c21-20-12-11-18(13-16-7-3-1-4-8-16)15-19(20)14-17-9-5-2-6-10-17/h1-3,5,7,9,11-12,15,21H,4,6,8,10,13-14H2 |
| InChIKey | QWQYIEPPDZBYLE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |