C10H19NO — CID 130391029
(2E,4E)-5-amino-3,6-dimethylocta-2,4-dien-2-ol (PubChem CID 130391029) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (2E,4E)-5-amino-3,6-dimethylocta-2,4-dien-2-ol.
| Compound Name | (2E,4E)-5-amino-3,6-dimethylocta-2,4-dien-2-ol |
|---|---|
| PubChem CID | 130391029 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (2E,4E)-5-amino-3,6-dimethylocta-2,4-dien-2-ol |
| SMILES | CCC(C)/C(N)=C\C(C)=C(/C)O |
| InChI | InChI=1S/C10H19NO/c1-5-7(2)10(11)6-8(3)9(4)12/h6-7,12H,5,11H2,1-4H3/b9-8+,10-6+ |
| InChIKey | CZEYIDLLDHPAGS-JSAGYHNASA-N |
| XLogP | 2.73 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|