C8H13NO — CID 130391051
(3Z,6E)-6-aminoocta-1,3,6-trien-2-ol (PubChem CID 130391051) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (3Z,6E)-6-aminoocta-1,3,6-trien-2-ol.
| Compound Name | (3Z,6E)-6-aminoocta-1,3,6-trien-2-ol |
|---|---|
| PubChem CID | 130391051 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (3Z,6E)-6-aminoocta-1,3,6-trien-2-ol |
| SMILES | C=C(O)/C=C\C/C(N)=C\C |
| InChI | InChI=1S/C8H13NO/c1-3-8(9)6-4-5-7(2)10/h3-5,10H,2,6,9H2,1H3/b5-4-,8-3+ |
| InChIKey | XCIXQJUZFNZYQO-UEQFWHKLSA-N |
| XLogP | 1.87 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|