C20H18ClFN4O6 — CID 130391407
2-[[[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]amino]methyl]-3-fluorobenzoic acid (PubChem CID 130391407) has the molecular formula C20H18ClFN4O6 and a molecular weight of 464.84 g/mol. Its IUPAC name is 2-[[[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]amino]methyl]-3-fluorobenzoic acid.
| Compound Name | 2-[[[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]amino]methyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 130391407 |
| Molecular Formula | C20H18ClFN4O6 |
| Molecular Weight | 464.84 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 2-[[[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-imidazo[4,5-b]pyridin-5-yl]amino]methyl]-3-fluorobenzoic acid |
| SMILES | O=C(O)c1cccc(F)c1CNc1nc2nc(O[C@@H]3CO[C@H]4[C@@H]3OC[C@H]4O)[nH]c2cc1Cl |
| InChI | InChI=1S/C20H18ClFN4O6/c21-10-4-12-18(25-17(10)23-5-9-8(19(28)29)2-1-3-11(9)22)26-20(24-12)32-14-7-31-15-13(27)6-30-16(14)15/h1-4,13-16,27H,5-7H2,(H,28,29)(H2,23,24,25,26)/t13-,14-,15-,16-/m1/s1 |
| InChIKey | IRSJFVDIHJLIIB-KLHDSHLOSA-N |
| XLogP | 1.97 |
| TPSA | 138.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.84 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |