C22H27ClN6O5 — CID 130391526
(3R,3aR,6R,6aR)-6-[[6-chloro-5-[[2-(oxan-2-ylmethyl)pyrazol-3-yl]methylamino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 130391526) has the molecular formula C22H27ClN6O5 and a molecular weight of 490.95 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[6-chloro-5-[[2-(oxan-2-ylmethyl)pyrazol-3-yl]methylamino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[[2-(oxan-2-ylmethyl)pyrazol-3-yl]methylamino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 130391526 |
| Molecular Formula | C22H27ClN6O5 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[[2-(oxan-2-ylmethyl)pyrazol-3-yl]methylamino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2Oc1nc2nc(NCc3ccnn3CC3CCCCO3)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C22H27ClN6O5/c23-14-7-15-21(28-22(26-15)34-17-11-33-18-16(30)10-32-19(17)18)27-20(14)24-8-12-4-5-25-29(12)9-13-3-1-2-6-31-13/h4-5,7,13,16-19,30H,1-3,6,8-11H2,(H2,24,26,27,28)/t13?,16-,17-,18-,19-/m1/s1 |
| InChIKey | DZISYDFLKDBMJR-UPOZUDDNSA-N |
| XLogP | 1.89 |
| TPSA | 128.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |