C15H16ClF2N3S — CID 130391567
1-[[(3E,5Z)-6-amino-5-chloro-2-[(2,6-difluorophenyl)methylimino]hexa-3,5-dien-3-yl]amino]ethenethiol (PubChem CID 130391567) has the molecular formula C15H16ClF2N3S and a molecular weight of 343.83 g/mol. Its IUPAC name is 1-[[(3E,5Z)-6-amino-5-chloro-2-[(2,6-difluorophenyl)methylimino]hexa-3,5-dien-3-yl]amino]ethenethiol.
| Compound Name | 1-[[(3E,5Z)-6-amino-5-chloro-2-[(2,6-difluorophenyl)methylimino]hexa-3,5-dien-3-yl]amino]ethenethiol |
|---|---|
| PubChem CID | 130391567 |
| Molecular Formula | C15H16ClF2N3S |
| Molecular Weight | 343.83 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 1-[[(3E,5Z)-6-amino-5-chloro-2-[(2,6-difluorophenyl)methylimino]hexa-3,5-dien-3-yl]amino]ethenethiol |
| SMILES | C=C(S)NC(=C/C(Cl)=C/N)/C(C)=N/Cc1c(F)cccc1F |
| InChI | InChI=1S/C15H16ClF2N3S/c1-9(15(21-10(2)22)6-11(16)7-19)20-8-12-13(17)4-3-5-14(12)18/h3-7,21-22H,2,8,19H2,1H3/b11-7-,15-6+,20-9+ |
| InChIKey | VCNIRGZQYKOHHE-LRTMCPRHSA-N |
| XLogP | 3.84 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.83 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|