About (2E,4Z)-6-aminohexa-2,4-diene-3-sulfonamide
(2E,4Z)-6-aminohexa-2,4-diene-3-sulfonamide (PubChem CID 130391754) has the molecular formula C6H12N2O2S
and a molecular weight of 176.24 g/mol. Its IUPAC name is (2E,4Z)-6-aminohexa-2,4-diene-3-sulfonamide.
Molecular Properties
| Compound Name | (2E,4Z)-6-aminohexa-2,4-diene-3-sulfonamide |
| PubChem CID | 130391754 |
| Molecular Formula | C6H12N2O2S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | (2E,4Z)-6-aminohexa-2,4-diene-3-sulfonamide |
| SMILES | C/C=C(\C=C/CN)S(N)(=O)=O |
| InChI | InChI=1S/C6H12N2O2S/c1-2-6(4-3-5-7)11(8,9)10/h2-4H,5,7H2,1H3,(H2,8,9,10)/b4-3-,6-2+ |
| InChIKey | OHAGXNQPLSIJIS-FSEBUJBSSA-N |
| XLogP | -0.31 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-6-aminohexa-2,4-diene-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-6-aminohexa-2,4-diene-3-sulfonamide?
The IUPAC name of (2E,4Z)-6-aminohexa-2,4-diene-3-sulfonamide (CID 130391754) is (2E,4Z)-6-aminohexa-2,4-diene-3-sulfonamide.
What is the SMILES notation for (2E,4Z)-6-aminohexa-2,4-diene-3-sulfonamide?
The canonical SMILES for (2E,4Z)-6-aminohexa-2,4-diene-3-sulfonamide is C/C=C(\C=C/CN)S(N)(=O)=O.
What is the InChIKey of (2E,4Z)-6-aminohexa-2,4-diene-3-sulfonamide?
The InChIKey is OHAGXNQPLSIJIS-FSEBUJBSSA-N. The full InChI is InChI=1S/C6H12N2O2S/c1-2-6(4-3-5-7)11(8,9)10/h2-4H,5,7H2,1H3,(H2,8,9,10)/b4-3-,6-2+.
What are the key properties of (2E,4Z)-6-aminohexa-2,4-diene-3-sulfonamide?
(2E,4Z)-6-aminohexa-2,4-diene-3-sulfonamide has a molecular weight of 176.24 g/mol, XLogP of -0.31, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-6-aminohexa-2,4-diene-3-sulfonamide is sourced from PubChem (CID 130391754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).