About trimethyl(4-prop-2-ynylocta-1,2-dien-4-yloxy)silane
trimethyl(4-prop-2-ynylocta-1,2-dien-4-yloxy)silane (PubChem CID 13039189) has the molecular formula C14H24OSi
and a molecular weight of 236.43 g/mol. Its IUPAC name is trimethyl(4-prop-2-ynylocta-1,2-dien-4-yloxy)silane.
Molecular Properties
| Compound Name | trimethyl(4-prop-2-ynylocta-1,2-dien-4-yloxy)silane |
| PubChem CID | 13039189 |
| Molecular Formula | C14H24OSi |
| Molecular Weight | 236.43 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | trimethyl(4-prop-2-ynylocta-1,2-dien-4-yloxy)silane |
| SMILES | C#CCC(C=C=C)(CCCC)O[Si](C)(C)C |
| InChI | InChI=1S/C14H24OSi/c1-7-10-13-14(11-8-2,12-9-3)15-16(4,5)6/h2,12H,3,7,10-11,13H2,1,4-6H3 |
| InChIKey | IWONHHXMOMOYLD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trimethyl(4-prop-2-ynylocta-1,2-dien-4-yloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(4-prop-2-ynylocta-1,2-dien-4-yloxy)silane?
The IUPAC name of trimethyl(4-prop-2-ynylocta-1,2-dien-4-yloxy)silane (CID 13039189) is trimethyl(4-prop-2-ynylocta-1,2-dien-4-yloxy)silane.
What is the SMILES notation for trimethyl(4-prop-2-ynylocta-1,2-dien-4-yloxy)silane?
The canonical SMILES for trimethyl(4-prop-2-ynylocta-1,2-dien-4-yloxy)silane is C#CCC(C=C=C)(CCCC)O[Si](C)(C)C.
What is the InChIKey of trimethyl(4-prop-2-ynylocta-1,2-dien-4-yloxy)silane?
The InChIKey is IWONHHXMOMOYLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24OSi/c1-7-10-13-14(11-8-2,12-9-3)15-16(4,5)6/h2,12H,3,7,10-11,13H2,1,4-6H3.
What are the key properties of trimethyl(4-prop-2-ynylocta-1,2-dien-4-yloxy)silane?
trimethyl(4-prop-2-ynylocta-1,2-dien-4-yloxy)silane has a molecular weight of 236.43 g/mol, XLogP of 4.13, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(4-prop-2-ynylocta-1,2-dien-4-yloxy)silane is sourced from PubChem (CID 13039189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).