C26H19F3O3S — CID 130392000
9-(4-methylsulfonylphenyl)-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene (PubChem CID 130392000) has the molecular formula C26H19F3O3S and a molecular weight of 468.50 g/mol. Its IUPAC name is 9-(4-methylsulfonylphenyl)-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene.
| Compound Name | 9-(4-methylsulfonylphenyl)-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene |
|---|---|
| PubChem CID | 130392000 |
| Molecular Formula | C26H19F3O3S |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 9-(4-methylsulfonylphenyl)-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc3ccc4c(c3c2)CCC(c2cc(F)c(F)cc2F)O4)cc1 |
| InChI | InChI=1S/C26H19F3O3S/c1-33(30,31)18-7-4-15(5-8-18)17-3-2-16-6-10-25-19(20(16)12-17)9-11-26(32-25)21-13-23(28)24(29)14-22(21)27/h2-8,10,12-14,26H,9,11H2,1H3 |
| InChIKey | BNGUWPYQWKXKTL-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|