C23H19F5N2O — CID 130392035
(2S,3R)-9-(3,3-difluoropyrrolidin-1-yl)-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromen-2-amine (PubChem CID 130392035) has the molecular formula C23H19F5N2O and a molecular weight of 434.41 g/mol. Its IUPAC name is (2S,3R)-9-(3,3-difluoropyrrolidin-1-yl)-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromen-2-amine.
| Compound Name | (2S,3R)-9-(3,3-difluoropyrrolidin-1-yl)-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromen-2-amine |
|---|---|
| PubChem CID | 130392035 |
| Molecular Formula | C23H19F5N2O |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (2S,3R)-9-(3,3-difluoropyrrolidin-1-yl)-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromen-2-amine |
| SMILES | N[C@H]1Cc2c(ccc3ccc(N4CCC(F)(F)C4)cc23)O[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C23H19F5N2O/c24-17-10-19(26)18(25)8-16(17)22-20(29)9-15-14-7-13(30-6-5-23(27,28)11-30)3-1-12(14)2-4-21(15)31-22/h1-4,7-8,10,20,22H,5-6,9,11,29H2/t20-,22+/m0/s1 |
| InChIKey | RQUSILVIOOQXKP-RBBKRZOGSA-N |
| XLogP | 5.11 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|