C23H21F3N2O2 — CID 130392115
8-morpholin-4-yl-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromen-2-amine (PubChem CID 130392115) has the molecular formula C23H21F3N2O2 and a molecular weight of 414.43 g/mol. Its IUPAC name is 8-morpholin-4-yl-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromen-2-amine.
| Compound Name | 8-morpholin-4-yl-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromen-2-amine |
|---|---|
| PubChem CID | 130392115 |
| Molecular Formula | C23H21F3N2O2 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 8-morpholin-4-yl-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromen-2-amine |
| SMILES | NC1Cc2c(ccc3cc(N4CCOCC4)ccc23)OC1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C23H21F3N2O2/c24-18-12-20(26)19(25)10-17(18)23-21(27)11-16-15-3-2-14(28-5-7-29-8-6-28)9-13(15)1-4-22(16)30-23/h1-4,9-10,12,21,23H,5-8,11,27H2 |
| InChIKey | KEEYJPHDGQFLMG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|