About 1-O-[4-(5-cyano-1H-pyrrol-2-yl)phenyl] 7-O-[4-(5-cyanothiophen-2-yl)phenyl] heptanedioate
1-O-[4-(5-cyano-1H-pyrrol-2-yl)phenyl] 7-O-[4-(5-cyanothiophen-2-yl)phenyl] heptanedioate (PubChem CID 130392188) has the molecular formula C29H23N3O4S
and a molecular weight of 509.59 g/mol. Its IUPAC name is 1-O-[4-(5-cyano-1H-pyrrol-2-yl)phenyl] 7-O-[4-(5-cyanothiophen-2-yl)phenyl] heptanedioate.
Molecular Properties
| Compound Name | 1-O-[4-(5-cyano-1H-pyrrol-2-yl)phenyl] 7-O-[4-(5-cyanothiophen-2-yl)phenyl] heptanedioate |
| PubChem CID | 130392188 |
| Molecular Formula | C29H23N3O4S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | 1-O-[4-(5-cyano-1H-pyrrol-2-yl)phenyl] 7-O-[4-(5-cyanothiophen-2-yl)phenyl] heptanedioate |
| SMILES | N#Cc1ccc(-c2ccc(OC(=O)CCCCCC(=O)Oc3ccc(-c4ccc(C#N)s4)cc3)cc2)[nH]1 |
| InChI | InChI=1S/C29H23N3O4S/c30-18-22-10-16-26(32-22)20-6-11-23(12-7-20)35-28(33)4-2-1-3-5-29(34)36-24-13-8-21(9-14-24)27-17-15-25(19-31)37-27/h6-17,32H,1-5H2 |
| InChIKey | HXVXELHPIGMEJZ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[4-(5-cyano-1H-pyrrol-2-yl)phenyl] 7-O-[4-(5-cyanothiophen-2-yl)phenyl] heptanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[4-(5-cyano-1H-pyrrol-2-yl)phenyl] 7-O-[4-(5-cyanothiophen-2-yl)phenyl] heptanedioate?
The IUPAC name of 1-O-[4-(5-cyano-1H-pyrrol-2-yl)phenyl] 7-O-[4-(5-cyanothiophen-2-yl)phenyl] heptanedioate (CID 130392188) is 1-O-[4-(5-cyano-1H-pyrrol-2-yl)phenyl] 7-O-[4-(5-cyanothiophen-2-yl)phenyl] heptanedioate.
What is the SMILES notation for 1-O-[4-(5-cyano-1H-pyrrol-2-yl)phenyl] 7-O-[4-(5-cyanothiophen-2-yl)phenyl] heptanedioate?
The canonical SMILES for 1-O-[4-(5-cyano-1H-pyrrol-2-yl)phenyl] 7-O-[4-(5-cyanothiophen-2-yl)phenyl] heptanedioate is N#Cc1ccc(-c2ccc(OC(=O)CCCCCC(=O)Oc3ccc(-c4ccc(C#N)s4)cc3)cc2)[nH]1.
What is the InChIKey of 1-O-[4-(5-cyano-1H-pyrrol-2-yl)phenyl] 7-O-[4-(5-cyanothiophen-2-yl)phenyl] heptanedioate?
The InChIKey is HXVXELHPIGMEJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H23N3O4S/c30-18-22-10-16-26(32-22)20-6-11-23(12-7-20)35-28(33)4-2-1-3-5-29(34)36-24-13-8-21(9-14-24)27-17-15-25(19-31)37-27/h6-17,32H,1-5H2.
What are the key properties of 1-O-[4-(5-cyano-1H-pyrrol-2-yl)phenyl] 7-O-[4-(5-cyanothiophen-2-yl)phenyl] heptanedioate?
1-O-[4-(5-cyano-1H-pyrrol-2-yl)phenyl] 7-O-[4-(5-cyanothiophen-2-yl)phenyl] heptanedioate has a molecular weight of 509.59 g/mol, XLogP of 6.62, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[4-(5-cyano-1H-pyrrol-2-yl)phenyl] 7-O-[4-(5-cyanothiophen-2-yl)phenyl] heptanedioate is sourced from PubChem (CID 130392188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).